C13H20F3N3O — CID 119152971
N'-methyl-N-(3,3,3-trifluoropropyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide (PubChem CID 119152971) has the molecular formula C13H20F3N3O and a molecular weight of 291.32 g/mol. Its IUPAC name is N'-methyl-N-(3,3,3-trifluoropropyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide.
| Compound Name | N'-methyl-N-(3,3,3-trifluoropropyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 119152971 |
| Molecular Formula | C13H20F3N3O |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N'-methyl-N-(3,3,3-trifluoropropyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
| SMILES | C/N=C(\NCCC(F)(F)F)N1CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C13H20F3N3O/c1-17-12(18-5-4-13(14,15)16)19-6-8-9(7-19)11-3-2-10(8)20-11/h8-11H,2-7H2,1H3,(H,17,18) |
| InChIKey | BXNVJZMAWUTVIV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|