C14H23F3IN3O — CID 119152972
N-ethyl-N'-(3,3,3-trifluoropropyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide (PubChem CID 119152972) has the molecular formula C14H23F3IN3O and a molecular weight of 433.26 g/mol. Its IUPAC name is N-ethyl-N'-(3,3,3-trifluoropropyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-(3,3,3-trifluoropropyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119152972 |
| Molecular Formula | C14H23F3IN3O |
| Molecular Weight | 433.26 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | N-ethyl-N'-(3,3,3-trifluoropropyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(F)(F)F)N1CC2C3CCC(O3)C2C1.I |
| InChI | InChI=1S/C14H22F3N3O.HI/c1-2-18-13(19-6-5-14(15,16)17)20-7-9-10(8-20)12-4-3-11(9)21-12;/h9-12H,2-8H2,1H3,(H,18,19);1H |
| InChIKey | BCZGAPJLQQAVAF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|