C15H23F3N6O — CID 119153227
N-ethyl-4-(4-methyl-3-oxopyrazin-2-yl)-N'-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide (PubChem CID 119153227) has the molecular formula C15H23F3N6O and a molecular weight of 360.38 g/mol. Its IUPAC name is N-ethyl-4-(4-methyl-3-oxopyrazin-2-yl)-N'-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(4-methyl-3-oxopyrazin-2-yl)-N'-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119153227 |
| Molecular Formula | C15H23F3N6O |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | N-ethyl-4-(4-methyl-3-oxopyrazin-2-yl)-N'-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCC(F)(F)F)N1CCN(c2nccn(C)c2=O)CC1 |
| InChI | InChI=1S/C15H23F3N6O/c1-3-19-14(21-5-4-15(16,17)18)24-10-8-23(9-11-24)12-13(25)22(2)7-6-20-12/h6-7H,3-5,8-11H2,1-2H3,(H,19,21) |
| InChIKey | ADYGWMWVRSEKNO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|