C16H29IN6 — CID 119154047
1-cyclobutyl-2-ethyl-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide (PubChem CID 119154047) has the molecular formula C16H29IN6 and a molecular weight of 432.35 g/mol. Its IUPAC name is 1-cyclobutyl-2-ethyl-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide.
| Compound Name | 1-cyclobutyl-2-ethyl-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119154047 |
| Molecular Formula | C16H29IN6 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 1-cyclobutyl-2-ethyl-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide |
| SMILES | CC/N=C(\NC1CCC1)NC1CCc2nc(C(C)C)nn2C1.I |
| InChI | InChI=1S/C16H28N6.HI/c1-4-17-16(18-12-6-5-7-12)19-13-8-9-14-20-15(11(2)3)21-22(14)10-13;/h11-13H,4-10H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | FIWYWMKWBQNROP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|