C15H26F3IN4O — CID 119155296
N'-methyl-N-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide (PubChem CID 119155296) has the molecular formula C15H26F3IN4O and a molecular weight of 462.30 g/mol. Its IUPAC name is N'-methyl-N-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119155296 |
| Molecular Formula | C15H26F3IN4O |
| Molecular Weight | 462.30 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | N'-methyl-N-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCN(C)CC(F)(F)F)N1CC2C3CCC(O3)C2C1.I |
| InChI | InChI=1S/C15H25F3N4O.HI/c1-19-14(20-5-6-21(2)9-15(16,17)18)22-7-10-11(8-22)13-4-3-12(10)23-13;/h10-13H,3-9H2,1-2H3,(H,19,20);1H |
| InChIKey | YUFXAOAFNIRGLG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|