C15H25F3N4O — CID 119155297
N'-methyl-N-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide (PubChem CID 119155297) has the molecular formula C15H25F3N4O and a molecular weight of 334.39 g/mol. Its IUPAC name is N'-methyl-N-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide.
| Compound Name | N'-methyl-N-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 119155297 |
| Molecular Formula | C15H25F3N4O |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | N'-methyl-N-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
| SMILES | C/N=C(\NCCN(C)CC(F)(F)F)N1CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C15H25F3N4O/c1-19-14(20-5-6-21(2)9-15(16,17)18)22-7-10-11(8-22)13-4-3-12(10)23-13/h10-13H,3-9H2,1-2H3,(H,19,20) |
| InChIKey | VQLCDWSUZLWMLN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|