C17H23FN4OS — CID 119157230
4-cyclopropyl-N-[(5-fluoro-2-methylsulfanylphenyl)methyl]-N'-methyl-3-oxopiperazine-1-carboximidamide (PubChem CID 119157230) has the molecular formula C17H23FN4OS and a molecular weight of 350.46 g/mol. Its IUPAC name is 4-cyclopropyl-N-[(5-fluoro-2-methylsulfanylphenyl)methyl]-N'-methyl-3-oxopiperazine-1-carboximidamide.
| Compound Name | 4-cyclopropyl-N-[(5-fluoro-2-methylsulfanylphenyl)methyl]-N'-methyl-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119157230 |
| Molecular Formula | C17H23FN4OS |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 4-cyclopropyl-N-[(5-fluoro-2-methylsulfanylphenyl)methyl]-N'-methyl-3-oxopiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cc(F)ccc1SC)N1CCN(C2CC2)C(=O)C1 |
| InChI | InChI=1S/C17H23FN4OS/c1-19-17(20-10-12-9-13(18)3-6-15(12)24-2)21-7-8-22(14-4-5-14)16(23)11-21/h3,6,9,14H,4-5,7-8,10-11H2,1-2H3,(H,19,20) |
| InChIKey | YLYBEIUGIWMEKM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|