C16H22F3IN4OS — CID 119157343
N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide (PubChem CID 119157343) has the molecular formula C16H22F3IN4OS and a molecular weight of 502.34 g/mol. Its IUPAC name is N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119157343 |
| Molecular Formula | C16H22F3IN4OS |
| Molecular Weight | 502.34 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCc1nc(C(F)(F)F)cs1)N1CC2C3CCC(O3)C2C1.I |
| InChI | InChI=1S/C16H21F3N4OS.HI/c1-20-15(21-5-4-14-22-13(8-25-14)16(17,18)19)23-6-9-10(7-23)12-3-2-11(9)24-12;/h8-12H,2-7H2,1H3,(H,20,21);1H |
| InChIKey | QVDICMVKVITDKA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|