C22H25ClN2O — CID 11915767
(5R,10bS)-5-(4-chlorophenyl)-2-hexyl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine (PubChem CID 11915767) has the molecular formula C22H25ClN2O and a molecular weight of 368.91 g/mol. Its IUPAC name is (5R,10bS)-5-(4-chlorophenyl)-2-hexyl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine.
| Compound Name | (5R,10bS)-5-(4-chlorophenyl)-2-hexyl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 11915767 |
| Molecular Formula | C22H25ClN2O |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (5R,10bS)-5-(4-chlorophenyl)-2-hexyl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
| SMILES | CCCCCCC1=NN2[C@@H](c3ccc(Cl)cc3)Oc3ccccc3[C@@H]2C1 |
| InChI | InChI=1S/C22H25ClN2O/c1-2-3-4-5-8-18-15-20-19-9-6-7-10-21(19)26-22(25(20)24-18)16-11-13-17(23)14-12-16/h6-7,9-14,20,22H,2-5,8,15H2,1H3/t20-,22+/m0/s1 |
| InChIKey | KLBPIDLYDHSJTG-RBBKRZOGSA-N |
| XLogP | 6.50 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|