C7H6N4O2 — CID 11915801
2-diazo-1-[(1R,2R)-2-(2-diazoacetyl)cyclopropyl]ethanone (PubChem CID 11915801) has the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. Its IUPAC name is 2-diazo-1-[(1R,2R)-2-(2-diazoacetyl)cyclopropyl]ethanone.
| Compound Name | 2-diazo-1-[(1R,2R)-2-(2-diazoacetyl)cyclopropyl]ethanone |
|---|---|
| PubChem CID | 11915801 |
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 2-diazo-1-[(1R,2R)-2-(2-diazoacetyl)cyclopropyl]ethanone |
| SMILES | [N-]=[N+]=CC(=O)[C@@H]1C[C@H]1C(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C7H6N4O2/c8-10-2-6(12)4-1-5(4)7(13)3-11-9/h2-5H,1H2/t4-,5-/m1/s1 |
| InChIKey | FAHLKJDNAIQZNM-RFZPGFLSSA-N |
| XLogP | -0.64 |
| TPSA | 106.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|