C19H22ClIN4O3 — CID 119159446
1-(3-chloro-4-methoxyphenyl)-2-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 119159446) has the molecular formula C19H22ClIN4O3 and a molecular weight of 516.77 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119159446 |
| Molecular Formula | C19H22ClIN4O3 |
| Molecular Weight | 516.77 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCN2C(=O)C3C4C=CC(C4)C3C2=O)cc1Cl.I |
| InChI | InChI=1S/C19H21ClN4O3.HI/c1-27-14-5-4-12(9-13(14)20)23-19(21)22-6-7-24-17(25)15-10-2-3-11(8-10)16(15)18(24)26;/h2-5,9-11,15-16H,6-8H2,1H3,(H3,21,22,23);1H |
| InChIKey | DNMDDVFSPPKKFT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.77 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|