C19H20N2O4 — CID 119159652
5-[[2-(cyclopropylmethoxy)-4-methylphenyl]methylcarbamoyl]pyridine-2-carboxylic acid (PubChem CID 119159652) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 5-[[2-(cyclopropylmethoxy)-4-methylphenyl]methylcarbamoyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[[2-(cyclopropylmethoxy)-4-methylphenyl]methylcarbamoyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 119159652 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 5-[[2-(cyclopropylmethoxy)-4-methylphenyl]methylcarbamoyl]pyridine-2-carboxylic acid |
| SMILES | Cc1ccc(CNC(=O)c2ccc(C(=O)O)nc2)c(OCC2CC2)c1 |
| InChI | InChI=1S/C19H20N2O4/c1-12-2-5-14(17(8-12)25-11-13-3-4-13)9-21-18(22)15-6-7-16(19(23)24)20-10-15/h2,5-8,10,13H,3-4,9,11H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | SNTSUHUSFUJDIN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |