C18H35IN4O3 — CID 119161505
2-[[[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]-(oxan-4-ylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 119161505) has the molecular formula C18H35IN4O3 and a molecular weight of 482.41 g/mol. Its IUPAC name is 2-[[[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]-(oxan-4-ylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]-(oxan-4-ylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 119161505 |
| Molecular Formula | C18H35IN4O3 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 2-[[[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]-(oxan-4-ylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COC1(C)CC(N/C(=N\CC(=O)N(C)C)NC2CCOCC2)C1(C)C.I |
| InChI | InChI=1S/C18H34N4O3.HI/c1-17(2)14(11-18(17,3)24-6)21-16(19-12-15(23)22(4)5)20-13-7-9-25-10-8-13;/h13-14H,7-12H2,1-6H3,(H2,19,20,21);1H |
| InChIKey | XESGDTVWJBIOJS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|