C19H18N2O4S — CID 11916372
[(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 2-[(S)-ethylsulfinyl]benzoate (PubChem CID 11916372) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is [(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 2-[(S)-ethylsulfinyl]benzoate.
| Compound Name | [(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 2-[(S)-ethylsulfinyl]benzoate |
|---|---|
| PubChem CID | 11916372 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | [(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 2-[(S)-ethylsulfinyl]benzoate |
| SMILES | CC[S@](=O)c1ccccc1C(=O)O[C@@H](C)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H18N2O4S/c1-3-26(24)17-7-5-4-6-16(17)19(23)25-13(2)18(22)21-15-10-8-14(12-20)9-11-15/h4-11,13H,3H2,1-2H3,(H,21,22)/t13-,26-/m0/s1 |
| InChIKey | GDCCPSOPKJQPAI-NRRJATNASA-N |
| XLogP | 2.87 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |