C16H22N2O4 — CID 11916455
[2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 1-oxidopyridin-1-ium-2-carboxylate (PubChem CID 11916455) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is [2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 1-oxidopyridin-1-ium-2-carboxylate.
| Compound Name | [2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 1-oxidopyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 11916455 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | [2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 1-oxidopyridin-1-ium-2-carboxylate |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)COC(=O)c1cccc[n+]1[O-] |
| InChI | InChI=1S/C16H22N2O4/c1-11-6-5-7-13(12(11)2)17-15(19)10-22-16(20)14-8-3-4-9-18(14)21/h3-4,8-9,11-13H,5-7,10H2,1-2H3,(H,17,19)/t11-,12-,13+/m1/s1 |
| InChIKey | KKFBAXHUOFKJJO-UPJWGTAASA-N |
| XLogP | 1.42 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|