C21H28N2O3S2 — CID 11916478
[2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate (PubChem CID 11916478) has the molecular formula C21H28N2O3S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is [2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate.
| Compound Name | [2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate |
|---|---|
| PubChem CID | 11916478 |
| Molecular Formula | C21H28N2O3S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)COC(=O)c1ccccc1CSC1=NCCS1 |
| InChI | InChI=1S/C21H28N2O3S2/c1-14-6-5-9-18(15(14)2)23-19(24)12-26-20(25)17-8-4-3-7-16(17)13-28-21-22-10-11-27-21/h3-4,7-8,14-15,18H,5-6,9-13H2,1-2H3,(H,23,24)/t14-,15-,18+/m1/s1 |
| InChIKey | IUQCMWFVOXRNLZ-RKVPGOIHSA-N |
| XLogP | 4.12 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |