C18H19NO4 — CID 11916756
(1,3-dioxoisoindol-2-yl)methyl 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate (PubChem CID 11916756) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
|---|---|
| PubChem CID | 11916756 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
| SMILES | O=C(C[C@@H]1C[C@H]2CC[C@@H]1C2)OCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H19NO4/c20-16(9-13-8-11-5-6-12(13)7-11)23-10-19-17(21)14-3-1-2-4-15(14)18(19)22/h1-4,11-13H,5-10H2/t11-,12+,13-/m0/s1 |
| InChIKey | JWYKJTODDJOYSZ-XQQFMLRXSA-N |
| XLogP | 2.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|