C23H25NO3 — CID 119168328
1-[1-(3-methylphenyl)cyclopropanecarbonyl]-4-phenylpiperidine-4-carboxylic acid (PubChem CID 119168328) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-[1-(3-methylphenyl)cyclopropanecarbonyl]-4-phenylpiperidine-4-carboxylic acid.
| Compound Name | 1-[1-(3-methylphenyl)cyclopropanecarbonyl]-4-phenylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119168328 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-[1-(3-methylphenyl)cyclopropanecarbonyl]-4-phenylpiperidine-4-carboxylic acid |
| SMILES | Cc1cccc(C2(C(=O)N3CCC(C(=O)O)(c4ccccc4)CC3)CC2)c1 |
| InChI | InChI=1S/C23H25NO3/c1-17-6-5-9-19(16-17)22(10-11-22)20(25)24-14-12-23(13-15-24,21(26)27)18-7-3-2-4-8-18/h2-9,16H,10-15H2,1H3,(H,26,27) |
| InChIKey | PBBZUQKPLYIHGA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |