About 4-[2-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbonyl)amino]ethyl]benzoic acid
4-[2-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbonyl)amino]ethyl]benzoic acid (PubChem CID 119168660) has the molecular formula C20H20N4O3S
and a molecular weight of 396.47 g/mol. Its IUPAC name is 4-[2-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbonyl)amino]ethyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[2-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbonyl)amino]ethyl]benzoic acid |
| PubChem CID | 119168660 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 4-[2-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbonyl)amino]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCNC(=O)C2CCCN2c2ncnc3sccc23)cc1 |
| InChI | InChI=1S/C20H20N4O3S/c25-18(21-9-7-13-3-5-14(6-4-13)20(26)27)16-2-1-10-24(16)17-15-8-11-28-19(15)23-12-22-17/h3-6,8,11-12,16H,1-2,7,9-10H2,(H,21,25)(H,26,27) |
| InChIKey | PXGBAJNZNMYIHJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbonyl)amino]ethyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbonyl)amino]ethyl]benzoic acid?
The IUPAC name of 4-[2-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbonyl)amino]ethyl]benzoic acid (CID 119168660) is 4-[2-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbonyl)amino]ethyl]benzoic acid.
What is the SMILES notation for 4-[2-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbonyl)amino]ethyl]benzoic acid?
The canonical SMILES for 4-[2-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbonyl)amino]ethyl]benzoic acid is O=C(O)c1ccc(CCNC(=O)C2CCCN2c2ncnc3sccc23)cc1.
What is the InChIKey of 4-[2-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbonyl)amino]ethyl]benzoic acid?
The InChIKey is PXGBAJNZNMYIHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4O3S/c25-18(21-9-7-13-3-5-14(6-4-13)20(26)27)16-2-1-10-24(16)17-15-8-11-28-19(15)23-12-22-17/h3-6,8,11-12,16H,1-2,7,9-10H2,(H,21,25)(H,26,27).
What are the key properties of 4-[2-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbonyl)amino]ethyl]benzoic acid?
4-[2-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbonyl)amino]ethyl]benzoic acid has a molecular weight of 396.47 g/mol, XLogP of 2.72, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbonyl)amino]ethyl]benzoic acid is sourced from PubChem (CID 119168660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).