C22H30N2O4 — CID 119168864
4-[2-[[4-(cyclopentanecarbonylamino)cyclohexanecarbonyl]amino]ethyl]benzoic acid (PubChem CID 119168864) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 4-[2-[[4-(cyclopentanecarbonylamino)cyclohexanecarbonyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[[4-(cyclopentanecarbonylamino)cyclohexanecarbonyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 119168864 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 4-[2-[[4-(cyclopentanecarbonylamino)cyclohexanecarbonyl]amino]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCNC(=O)C2CCC(NC(=O)C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C22H30N2O4/c25-20(23-14-13-15-5-7-18(8-6-15)22(27)28)17-9-11-19(12-10-17)24-21(26)16-3-1-2-4-16/h5-8,16-17,19H,1-4,9-14H2,(H,23,25)(H,24,26)(H,27,28) |
| InChIKey | ZBEZGVZSLJJYMQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |