C18H22BrNO4 — CID 119169166
1-[2-(5-bromo-2-methoxyphenyl)acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 119169166) has the molecular formula C18H22BrNO4 and a molecular weight of 396.28 g/mol. Its IUPAC name is 1-[2-(5-bromo-2-methoxyphenyl)acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[2-(5-bromo-2-methoxyphenyl)acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 119169166 |
| Molecular Formula | C18H22BrNO4 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 1-[2-(5-bromo-2-methoxyphenyl)acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | COc1ccc(Br)cc1CC(=O)N1C(C(=O)O)CC2CCCCC21 |
| InChI | InChI=1S/C18H22BrNO4/c1-24-16-7-6-13(19)8-12(16)10-17(21)20-14-5-3-2-4-11(14)9-15(20)18(22)23/h6-8,11,14-15H,2-5,9-10H2,1H3,(H,22,23) |
| InChIKey | VSVKKLFQTPTOSX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |