C17H22INO3 — CID 11916922
[2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-iodobenzoate (PubChem CID 11916922) has the molecular formula C17H22INO3 and a molecular weight of 415.27 g/mol. Its IUPAC name is [2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-iodobenzoate.
| Compound Name | [2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-iodobenzoate |
|---|---|
| PubChem CID | 11916922 |
| Molecular Formula | C17H22INO3 |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | [2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-iodobenzoate |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=O)COC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C17H22INO3/c1-11-4-3-5-15(12(11)2)19-16(20)10-22-17(21)13-6-8-14(18)9-7-13/h6-9,11-12,15H,3-5,10H2,1-2H3,(H,19,20)/t11-,12-,15-/m1/s1 |
| InChIKey | AWURNTZRMJTBRE-LALPHHSUSA-N |
| XLogP | 3.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|