C16H20N4O3 — CID 119170359
3-methyl-2-[[5-methyl-1-(4-methylphenyl)triazole-4-carbonyl]amino]butanoic acid (PubChem CID 119170359) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-methyl-2-[[5-methyl-1-(4-methylphenyl)triazole-4-carbonyl]amino]butanoic acid.
| Compound Name | 3-methyl-2-[[5-methyl-1-(4-methylphenyl)triazole-4-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119170359 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 3-methyl-2-[[5-methyl-1-(4-methylphenyl)triazole-4-carbonyl]amino]butanoic acid |
| SMILES | Cc1ccc(-n2nnc(C(=O)NC(C(=O)O)C(C)C)c2C)cc1 |
| InChI | InChI=1S/C16H20N4O3/c1-9(2)13(16(22)23)17-15(21)14-11(4)20(19-18-14)12-7-5-10(3)6-8-12/h5-9,13H,1-4H3,(H,17,21)(H,22,23) |
| InChIKey | SDUDSCJOPMSMLC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |