C16H25N3O5S — CID 119170435
3-methyl-2-[(1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carbonyl)amino]butanoic acid (PubChem CID 119170435) has the molecular formula C16H25N3O5S and a molecular weight of 371.46 g/mol. Its IUPAC name is 3-methyl-2-[(1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carbonyl)amino]butanoic acid.
| Compound Name | 3-methyl-2-[(1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 119170435 |
| Molecular Formula | C16H25N3O5S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 3-methyl-2-[(1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carbonyl)amino]butanoic acid |
| SMILES | CC(C)C(NC(=O)c1cc(S(=O)(=O)N2CCCCC2)cn1C)C(=O)O |
| InChI | InChI=1S/C16H25N3O5S/c1-11(2)14(16(21)22)17-15(20)13-9-12(10-18(13)3)25(23,24)19-7-5-4-6-8-19/h9-11,14H,4-8H2,1-3H3,(H,17,20)(H,21,22) |
| InChIKey | JYORVKWZDMRNDW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |