C17H22N2O3 — CID 119170480
3-methyl-2-[3-(7-methyl-1H-indol-3-yl)propanoylamino]butanoic acid (PubChem CID 119170480) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 3-methyl-2-[3-(7-methyl-1H-indol-3-yl)propanoylamino]butanoic acid.
| Compound Name | 3-methyl-2-[3-(7-methyl-1H-indol-3-yl)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 119170480 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 3-methyl-2-[3-(7-methyl-1H-indol-3-yl)propanoylamino]butanoic acid |
| SMILES | Cc1cccc2c(CCC(=O)NC(C(=O)O)C(C)C)c[nH]c12 |
| InChI | InChI=1S/C17H22N2O3/c1-10(2)15(17(21)22)19-14(20)8-7-12-9-18-16-11(3)5-4-6-13(12)16/h4-6,9-10,15,18H,7-8H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | XZIKUEVLVRFXDD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |