C15H20ClNO3 — CID 119172027
2-[[2-(4-chlorophenyl)-2-ethylbutanoyl]-methylamino]acetic acid (PubChem CID 119172027) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenyl)-2-ethylbutanoyl]-methylamino]acetic acid.
| Compound Name | 2-[[2-(4-chlorophenyl)-2-ethylbutanoyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 119172027 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-[[2-(4-chlorophenyl)-2-ethylbutanoyl]-methylamino]acetic acid |
| SMILES | CCC(CC)(C(=O)N(C)CC(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H20ClNO3/c1-4-15(5-2,11-6-8-12(16)9-7-11)14(20)17(3)10-13(18)19/h6-9H,4-5,10H2,1-3H3,(H,18,19) |
| InChIKey | XBKWNRPBSYKWFW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |