C14H14F2N4O4 — CID 119172030
2-[[1-[4-(difluoromethoxy)phenyl]-5-methyltriazole-4-carbonyl]-methylamino]acetic acid (PubChem CID 119172030) has the molecular formula C14H14F2N4O4 and a molecular weight of 340.29 g/mol. Its IUPAC name is 2-[[1-[4-(difluoromethoxy)phenyl]-5-methyltriazole-4-carbonyl]-methylamino]acetic acid.
| Compound Name | 2-[[1-[4-(difluoromethoxy)phenyl]-5-methyltriazole-4-carbonyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 119172030 |
| Molecular Formula | C14H14F2N4O4 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-[[1-[4-(difluoromethoxy)phenyl]-5-methyltriazole-4-carbonyl]-methylamino]acetic acid |
| SMILES | Cc1c(C(=O)N(C)CC(=O)O)nnn1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H14F2N4O4/c1-8-12(13(23)19(2)7-11(21)22)17-18-20(8)9-3-5-10(6-4-9)24-14(15)16/h3-6,14H,7H2,1-2H3,(H,21,22) |
| InChIKey | WTYMDMSVNNOUDJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |