C21H19FN2O6 — CID 11917248
trimethyl (2S,3R,8aR)-3-cyano-2-(2-fluorophenyl)-3,8a-dihydro-2H-indolizine-1,1,6-tricarboxylate (PubChem CID 11917248) has the molecular formula C21H19FN2O6 and a molecular weight of 414.39 g/mol. Its IUPAC name is trimethyl (2S,3R,8aR)-3-cyano-2-(2-fluorophenyl)-3,8a-dihydro-2H-indolizine-1,1,6-tricarboxylate.
| Compound Name | trimethyl (2S,3R,8aR)-3-cyano-2-(2-fluorophenyl)-3,8a-dihydro-2H-indolizine-1,1,6-tricarboxylate |
|---|---|
| PubChem CID | 11917248 |
| Molecular Formula | C21H19FN2O6 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | trimethyl (2S,3R,8aR)-3-cyano-2-(2-fluorophenyl)-3,8a-dihydro-2H-indolizine-1,1,6-tricarboxylate |
| SMILES | COC(=O)C1=CN2[C@@H](C#N)[C@H](c3ccccc3F)C(C(=O)OC)(C(=O)OC)[C@H]2C=C1 |
| InChI | InChI=1S/C21H19FN2O6/c1-28-18(25)12-8-9-16-21(19(26)29-2,20(27)30-3)17(15(10-23)24(16)11-12)13-6-4-5-7-14(13)22/h4-9,11,15-17H,1-3H3/t15-,16+,17-/m0/s1 |
| InChIKey | UDFOEALRXYBWIX-BBWFWOEESA-N |
| XLogP | 1.44 |
| TPSA | 105.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|