C17H23NO3S — CID 119173833
(3S)-1-[2-(4-propan-2-ylphenyl)sulfanylacetyl]piperidine-3-carboxylic acid (PubChem CID 119173833) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is (3S)-1-[2-(4-propan-2-ylphenyl)sulfanylacetyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[2-(4-propan-2-ylphenyl)sulfanylacetyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119173833 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (3S)-1-[2-(4-propan-2-ylphenyl)sulfanylacetyl]piperidine-3-carboxylic acid |
| SMILES | CC(C)c1ccc(SCC(=O)N2CCC[C@H](C(=O)O)C2)cc1 |
| InChI | InChI=1S/C17H23NO3S/c1-12(2)13-5-7-15(8-6-13)22-11-16(19)18-9-3-4-14(10-18)17(20)21/h5-8,12,14H,3-4,9-11H2,1-2H3,(H,20,21)/t14-/m0/s1 |
| InChIKey | ZHQVQVLESXWDIS-AWEZNQCLSA-N |
| XLogP | 3.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |