C18H20N2O5S — CID 119173841
(3S)-1-[1-(4-methylphenyl)sulfonylpyrrole-3-carbonyl]piperidine-3-carboxylic acid (PubChem CID 119173841) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is (3S)-1-[1-(4-methylphenyl)sulfonylpyrrole-3-carbonyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[1-(4-methylphenyl)sulfonylpyrrole-3-carbonyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119173841 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (3S)-1-[1-(4-methylphenyl)sulfonylpyrrole-3-carbonyl]piperidine-3-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc(C(=O)N3CCC[C@H](C(=O)O)C3)c2)cc1 |
| InChI | InChI=1S/C18H20N2O5S/c1-13-4-6-16(7-5-13)26(24,25)20-10-8-14(12-20)17(21)19-9-2-3-15(11-19)18(22)23/h4-8,10,12,15H,2-3,9,11H2,1H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | DVKVVVDKTPORAH-HNNXBMFYSA-N |
| XLogP | 1.97 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |