C18H25NO3 — CID 11917453
2-(3-acetylphenoxy)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide (PubChem CID 11917453) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 2-(3-acetylphenoxy)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | 2-(3-acetylphenoxy)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 11917453 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-(3-acetylphenoxy)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
| SMILES | CC(=O)c1cccc(OCC(=O)N[C@@H]2CCC[C@H](C)[C@H]2C)c1 |
| InChI | InChI=1S/C18H25NO3/c1-12-6-4-9-17(13(12)2)19-18(21)11-22-16-8-5-7-15(10-16)14(3)20/h5,7-8,10,12-13,17H,4,6,9,11H2,1-3H3,(H,19,21)/t12-,13+,17+/m0/s1 |
| InChIKey | RNCRZPMBDPMOMH-OGHNNQOOSA-N |
| XLogP | 3.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |