About 6-[2-(3,4-dichlorophenyl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid
6-[2-(3,4-dichlorophenyl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid (PubChem CID 119175536) has the molecular formula C17H19Cl2NO3
and a molecular weight of 356.25 g/mol. Its IUPAC name is 6-[2-(3,4-dichlorophenyl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-[2-(3,4-dichlorophenyl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid |
| PubChem CID | 119175536 |
| Molecular Formula | C17H19Cl2NO3 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 6-[2-(3,4-dichlorophenyl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid |
| SMILES | CC(C(=O)N1CCC2(CC1)CC2C(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H19Cl2NO3/c1-10(11-2-3-13(18)14(19)8-11)15(21)20-6-4-17(5-7-20)9-12(17)16(22)23/h2-3,8,10,12H,4-7,9H2,1H3,(H,22,23) |
| InChIKey | QRCVNADNFNFSNC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-[2-(3,4-dichlorophenyl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(3,4-dichlorophenyl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid?
The IUPAC name of 6-[2-(3,4-dichlorophenyl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid (CID 119175536) is 6-[2-(3,4-dichlorophenyl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid.
What is the SMILES notation for 6-[2-(3,4-dichlorophenyl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid?
The canonical SMILES for 6-[2-(3,4-dichlorophenyl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid is CC(C(=O)N1CCC2(CC1)CC2C(=O)O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 6-[2-(3,4-dichlorophenyl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid?
The InChIKey is QRCVNADNFNFSNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19Cl2NO3/c1-10(11-2-3-13(18)14(19)8-11)15(21)20-6-4-17(5-7-20)9-12(17)16(22)23/h2-3,8,10,12H,4-7,9H2,1H3,(H,22,23).
What are the key properties of 6-[2-(3,4-dichlorophenyl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid?
6-[2-(3,4-dichlorophenyl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid has a molecular weight of 356.25 g/mol, XLogP of 3.81, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(3,4-dichlorophenyl)propanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid is sourced from PubChem (CID 119175536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).