C18H31NO3S — CID 11917730
N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-1-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonamide (PubChem CID 11917730) has the molecular formula C18H31NO3S and a molecular weight of 341.52 g/mol. Its IUPAC name is N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-1-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonamide.
| Compound Name | N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-1-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonamide |
|---|---|
| PubChem CID | 11917730 |
| Molecular Formula | C18H31NO3S |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-1-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NS(=O)(=O)C[C@]12CC[C@H](CC1=O)C2(C)C |
| InChI | InChI=1S/C18H31NO3S/c1-12-6-5-7-15(13(12)2)19-23(21,22)11-18-9-8-14(10-16(18)20)17(18,3)4/h12-15,19H,5-11H2,1-4H3/t12-,13-,14-,15+,18-/m1/s1 |
| InChIKey | HJUGKOUQHCVTRC-ZURLZEQWSA-N |
| XLogP | 3.13 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |