C16H21FN2O5S — CID 119178388
2-[1-[3-[(4-fluorophenyl)sulfonylamino]propanoyl]piperidin-4-yl]acetic acid (PubChem CID 119178388) has the molecular formula C16H21FN2O5S and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-[1-[3-[(4-fluorophenyl)sulfonylamino]propanoyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[3-[(4-fluorophenyl)sulfonylamino]propanoyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 119178388 |
| Molecular Formula | C16H21FN2O5S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-[1-[3-[(4-fluorophenyl)sulfonylamino]propanoyl]piperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1CCN(C(=O)CCNS(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H21FN2O5S/c17-13-1-3-14(4-2-13)25(23,24)18-8-5-15(20)19-9-6-12(7-10-19)11-16(21)22/h1-4,12,18H,5-11H2,(H,21,22) |
| InChIKey | YCTBUQMSPCLRJV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |