C20H24N2O4 — CID 119178434
2-[1-[4-(5-phenyl-1,3-oxazol-2-yl)butanoyl]piperidin-4-yl]acetic acid (PubChem CID 119178434) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-[1-[4-(5-phenyl-1,3-oxazol-2-yl)butanoyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[4-(5-phenyl-1,3-oxazol-2-yl)butanoyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 119178434 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-[1-[4-(5-phenyl-1,3-oxazol-2-yl)butanoyl]piperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1CCN(C(=O)CCCc2ncc(-c3ccccc3)o2)CC1 |
| InChI | InChI=1S/C20H24N2O4/c23-19(22-11-9-15(10-12-22)13-20(24)25)8-4-7-18-21-14-17(26-18)16-5-2-1-3-6-16/h1-3,5-6,14-15H,4,7-13H2,(H,24,25) |
| InChIKey | JJBGGWNRNCHOKT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |