C19H21NO3 — CID 119179454
4-[3-[methyl-[(2-methylphenyl)methyl]amino]-3-oxopropyl]benzoic acid (PubChem CID 119179454) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is 4-[3-[methyl-[(2-methylphenyl)methyl]amino]-3-oxopropyl]benzoic acid.
| Compound Name | 4-[3-[methyl-[(2-methylphenyl)methyl]amino]-3-oxopropyl]benzoic acid |
|---|---|
| PubChem CID | 119179454 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 4-[3-[methyl-[(2-methylphenyl)methyl]amino]-3-oxopropyl]benzoic acid |
| SMILES | Cc1ccccc1CN(C)C(=O)CCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H21NO3/c1-14-5-3-4-6-17(14)13-20(2)18(21)12-9-15-7-10-16(11-8-15)19(22)23/h3-8,10-11H,9,12-13H2,1-2H3,(H,22,23) |
| InChIKey | CEZAHRRZMKMIJM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |