C20H28N2O6 — CID 119179623
2-[2-ethoxy-4-[3-(2-oxoazepan-1-yl)propylcarbamoyl]phenoxy]acetic acid (PubChem CID 119179623) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[3-(2-oxoazepan-1-yl)propylcarbamoyl]phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-4-[3-(2-oxoazepan-1-yl)propylcarbamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119179623 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 2-[2-ethoxy-4-[3-(2-oxoazepan-1-yl)propylcarbamoyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(C(=O)NCCCN2CCCCCC2=O)ccc1OCC(=O)O |
| InChI | InChI=1S/C20H28N2O6/c1-2-27-17-13-15(8-9-16(17)28-14-19(24)25)20(26)21-10-6-12-22-11-5-3-4-7-18(22)23/h8-9,13H,2-7,10-12,14H2,1H3,(H,21,26)(H,24,25) |
| InChIKey | LQJOCPBTCLDSCE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|