C19H12ClN3O3S — CID 1191816
5-(4-chlorophenyl)-3-[(4-nitrophenyl)methyl]thieno[2,3-d]pyrimidin-4-one (PubChem CID 1191816) has the molecular formula C19H12ClN3O3S and a molecular weight of 397.84 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[(4-nitrophenyl)methyl]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(4-chlorophenyl)-3-[(4-nitrophenyl)methyl]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 1191816 |
| Molecular Formula | C19H12ClN3O3S |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[(4-nitrophenyl)methyl]thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c(-c3ccc(Cl)cc3)csc2ncn1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H12ClN3O3S/c20-14-5-3-13(4-6-14)16-10-27-18-17(16)19(24)22(11-21-18)9-12-1-7-15(8-2-12)23(25)26/h1-8,10-11H,9H2 |
| InChIKey | KGRKYAKMGKZZEB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|