C16H15N3O4S — CID 119181949
4-[4-(thiophene-3-carbonyl)piperazine-1-carbonyl]pyridine-2-carboxylic acid (PubChem CID 119181949) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is 4-[4-(thiophene-3-carbonyl)piperazine-1-carbonyl]pyridine-2-carboxylic acid.
| Compound Name | 4-[4-(thiophene-3-carbonyl)piperazine-1-carbonyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 119181949 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-[4-(thiophene-3-carbonyl)piperazine-1-carbonyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)N2CCN(C(=O)c3ccsc3)CC2)ccn1 |
| InChI | InChI=1S/C16H15N3O4S/c20-14(11-1-3-17-13(9-11)16(22)23)18-4-6-19(7-5-18)15(21)12-2-8-24-10-12/h1-3,8-10H,4-7H2,(H,22,23) |
| InChIKey | LUNDVXNCTRCPFI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |