C20H21N3O5 — CID 119182748
6-[4-[2-(3-methoxyphenyl)acetyl]piperazine-1-carbonyl]pyridine-2-carboxylic acid (PubChem CID 119182748) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 6-[4-[2-(3-methoxyphenyl)acetyl]piperazine-1-carbonyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[4-[2-(3-methoxyphenyl)acetyl]piperazine-1-carbonyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 119182748 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 6-[4-[2-(3-methoxyphenyl)acetyl]piperazine-1-carbonyl]pyridine-2-carboxylic acid |
| SMILES | COc1cccc(CC(=O)N2CCN(C(=O)c3cccc(C(=O)O)n3)CC2)c1 |
| InChI | InChI=1S/C20H21N3O5/c1-28-15-5-2-4-14(12-15)13-18(24)22-8-10-23(11-9-22)19(25)16-6-3-7-17(21-16)20(26)27/h2-7,12H,8-11,13H2,1H3,(H,26,27) |
| InChIKey | KZGCXMLFJWUVCK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |