About 5-[2,2-difluoroethyl(2-methoxyethyl)carbamoyl]thiophene-2-carboxylic acid
5-[2,2-difluoroethyl(2-methoxyethyl)carbamoyl]thiophene-2-carboxylic acid (PubChem CID 119183837) has the molecular formula C11H13F2NO4S
and a molecular weight of 293.29 g/mol. Its IUPAC name is 5-[2,2-difluoroethyl(2-methoxyethyl)carbamoyl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[2,2-difluoroethyl(2-methoxyethyl)carbamoyl]thiophene-2-carboxylic acid |
| PubChem CID | 119183837 |
| Molecular Formula | C11H13F2NO4S |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 5-[2,2-difluoroethyl(2-methoxyethyl)carbamoyl]thiophene-2-carboxylic acid |
| SMILES | COCCN(CC(F)F)C(=O)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C11H13F2NO4S/c1-18-5-4-14(6-9(12)13)10(15)7-2-3-8(19-7)11(16)17/h2-3,9H,4-6H2,1H3,(H,16,17) |
| InChIKey | LBZXFNQMGPRBGE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2,2-difluoroethyl(2-methoxyethyl)carbamoyl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,2-difluoroethyl(2-methoxyethyl)carbamoyl]thiophene-2-carboxylic acid?
The IUPAC name of 5-[2,2-difluoroethyl(2-methoxyethyl)carbamoyl]thiophene-2-carboxylic acid (CID 119183837) is 5-[2,2-difluoroethyl(2-methoxyethyl)carbamoyl]thiophene-2-carboxylic acid.
What is the SMILES notation for 5-[2,2-difluoroethyl(2-methoxyethyl)carbamoyl]thiophene-2-carboxylic acid?
The canonical SMILES for 5-[2,2-difluoroethyl(2-methoxyethyl)carbamoyl]thiophene-2-carboxylic acid is COCCN(CC(F)F)C(=O)c1ccc(C(=O)O)s1.
What is the InChIKey of 5-[2,2-difluoroethyl(2-methoxyethyl)carbamoyl]thiophene-2-carboxylic acid?
The InChIKey is LBZXFNQMGPRBGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NO4S/c1-18-5-4-14(6-9(12)13)10(15)7-2-3-8(19-7)11(16)17/h2-3,9H,4-6H2,1H3,(H,16,17).
What are the key properties of 5-[2,2-difluoroethyl(2-methoxyethyl)carbamoyl]thiophene-2-carboxylic acid?
5-[2,2-difluoroethyl(2-methoxyethyl)carbamoyl]thiophene-2-carboxylic acid has a molecular weight of 293.29 g/mol, XLogP of 1.80, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,2-difluoroethyl(2-methoxyethyl)carbamoyl]thiophene-2-carboxylic acid is sourced from PubChem (CID 119183837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).