C21H23N3O3 — CID 119185805
4-[3-[3-(1-methylbenzimidazol-2-yl)propylamino]-3-oxopropyl]benzoic acid (PubChem CID 119185805) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-[3-[3-(1-methylbenzimidazol-2-yl)propylamino]-3-oxopropyl]benzoic acid.
| Compound Name | 4-[3-[3-(1-methylbenzimidazol-2-yl)propylamino]-3-oxopropyl]benzoic acid |
|---|---|
| PubChem CID | 119185805 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 4-[3-[3-(1-methylbenzimidazol-2-yl)propylamino]-3-oxopropyl]benzoic acid |
| SMILES | Cn1c(CCCNC(=O)CCc2ccc(C(=O)O)cc2)nc2ccccc21 |
| InChI | InChI=1S/C21H23N3O3/c1-24-18-6-3-2-5-17(18)23-19(24)7-4-14-22-20(25)13-10-15-8-11-16(12-9-15)21(26)27/h2-3,5-6,8-9,11-12H,4,7,10,13-14H2,1H3,(H,22,25)(H,26,27) |
| InChIKey | JWFMNZRBRZMFDS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|