About 4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]carbamoyl]pyridine-2-carboxylic acid
4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]carbamoyl]pyridine-2-carboxylic acid (PubChem CID 119186302) has the molecular formula C19H20N2O3
and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]carbamoyl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]carbamoyl]pyridine-2-carboxylic acid |
| PubChem CID | 119186302 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]carbamoyl]pyridine-2-carboxylic acid |
| SMILES | Cc1ccc(CN(C(=O)c2ccnc(C(=O)O)c2)C2CC2)cc1C |
| InChI | InChI=1S/C19H20N2O3/c1-12-3-4-14(9-13(12)2)11-21(16-5-6-16)18(22)15-7-8-20-17(10-15)19(23)24/h3-4,7-10,16H,5-6,11H2,1-2H3,(H,23,24) |
| InChIKey | XEJAISVGYSKAMM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]carbamoyl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]carbamoyl]pyridine-2-carboxylic acid?
The IUPAC name of 4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]carbamoyl]pyridine-2-carboxylic acid (CID 119186302) is 4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]carbamoyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]carbamoyl]pyridine-2-carboxylic acid?
The canonical SMILES for 4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]carbamoyl]pyridine-2-carboxylic acid is Cc1ccc(CN(C(=O)c2ccnc(C(=O)O)c2)C2CC2)cc1C.
What is the InChIKey of 4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]carbamoyl]pyridine-2-carboxylic acid?
The InChIKey is XEJAISVGYSKAMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O3/c1-12-3-4-14(9-13(12)2)11-21(16-5-6-16)18(22)15-7-8-20-17(10-15)19(23)24/h3-4,7-10,16H,5-6,11H2,1-2H3,(H,23,24).
What are the key properties of 4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]carbamoyl]pyridine-2-carboxylic acid?
4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]carbamoyl]pyridine-2-carboxylic acid has a molecular weight of 324.38 g/mol, XLogP of 3.20, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]carbamoyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 119186302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).