C18H19NO4S — CID 119186829
5-[3-(phenylmethoxymethyl)pyrrolidine-1-carbonyl]thiophene-2-carboxylic acid (PubChem CID 119186829) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is 5-[3-(phenylmethoxymethyl)pyrrolidine-1-carbonyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-(phenylmethoxymethyl)pyrrolidine-1-carbonyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 119186829 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 5-[3-(phenylmethoxymethyl)pyrrolidine-1-carbonyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)N2CCC(COCc3ccccc3)C2)s1 |
| InChI | InChI=1S/C18H19NO4S/c20-17(15-6-7-16(24-15)18(21)22)19-9-8-14(10-19)12-23-11-13-4-2-1-3-5-13/h1-7,14H,8-12H2,(H,21,22) |
| InChIKey | RCTRRXSVBWMATG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |