C15H17FN2O4 — CID 119189734
2-[[2-(6-fluoro-1H-indol-3-yl)acetyl]-(2-methoxyethyl)amino]acetic acid (PubChem CID 119189734) has the molecular formula C15H17FN2O4 and a molecular weight of 308.31 g/mol. Its IUPAC name is 2-[[2-(6-fluoro-1H-indol-3-yl)acetyl]-(2-methoxyethyl)amino]acetic acid.
| Compound Name | 2-[[2-(6-fluoro-1H-indol-3-yl)acetyl]-(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 119189734 |
| Molecular Formula | C15H17FN2O4 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-[[2-(6-fluoro-1H-indol-3-yl)acetyl]-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)Cc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C15H17FN2O4/c1-22-5-4-18(9-15(20)21)14(19)6-10-8-17-13-7-11(16)2-3-12(10)13/h2-3,7-8,17H,4-6,9H2,1H3,(H,20,21) |
| InChIKey | PTHOHXCBOOLTFD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |