C17H24FNO4 — CID 119190522
3-[4-(4-fluorophenoxy)butanoyl-(2-methylpropyl)amino]propanoic acid (PubChem CID 119190522) has the molecular formula C17H24FNO4 and a molecular weight of 325.38 g/mol. Its IUPAC name is 3-[4-(4-fluorophenoxy)butanoyl-(2-methylpropyl)amino]propanoic acid.
| Compound Name | 3-[4-(4-fluorophenoxy)butanoyl-(2-methylpropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119190522 |
| Molecular Formula | C17H24FNO4 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 3-[4-(4-fluorophenoxy)butanoyl-(2-methylpropyl)amino]propanoic acid |
| SMILES | CC(C)CN(CCC(=O)O)C(=O)CCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C17H24FNO4/c1-13(2)12-19(10-9-17(21)22)16(20)4-3-11-23-15-7-5-14(18)6-8-15/h5-8,13H,3-4,9-12H2,1-2H3,(H,21,22) |
| InChIKey | DHXATJOYAVAVAH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|