C18H27NO4 — CID 119190845
3-[ethyl-[2-(5-methyl-2-propan-2-ylphenoxy)propanoyl]amino]propanoic acid (PubChem CID 119190845) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-[ethyl-[2-(5-methyl-2-propan-2-ylphenoxy)propanoyl]amino]propanoic acid.
| Compound Name | 3-[ethyl-[2-(5-methyl-2-propan-2-ylphenoxy)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119190845 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 3-[ethyl-[2-(5-methyl-2-propan-2-ylphenoxy)propanoyl]amino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)C(C)Oc1cc(C)ccc1C(C)C |
| InChI | InChI=1S/C18H27NO4/c1-6-19(10-9-17(20)21)18(22)14(5)23-16-11-13(4)7-8-15(16)12(2)3/h7-8,11-12,14H,6,9-10H2,1-5H3,(H,20,21) |
| InChIKey | WGTZAYZXASBNSF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |