C18H22N2O3 — CID 119191067
3-[ethyl-[3-(5-phenyl-1H-pyrrol-2-yl)propanoyl]amino]propanoic acid (PubChem CID 119191067) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 3-[ethyl-[3-(5-phenyl-1H-pyrrol-2-yl)propanoyl]amino]propanoic acid.
| Compound Name | 3-[ethyl-[3-(5-phenyl-1H-pyrrol-2-yl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119191067 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 3-[ethyl-[3-(5-phenyl-1H-pyrrol-2-yl)propanoyl]amino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)CCc1ccc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C18H22N2O3/c1-2-20(13-12-18(22)23)17(21)11-9-15-8-10-16(19-15)14-6-4-3-5-7-14/h3-8,10,19H,2,9,11-13H2,1H3,(H,22,23) |
| InChIKey | CRODRMDSKSXECN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |