C15H18N2O5S — CID 119191082
3-[ethyl-[4-(prop-2-ynylsulfamoyl)benzoyl]amino]propanoic acid (PubChem CID 119191082) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is 3-[ethyl-[4-(prop-2-ynylsulfamoyl)benzoyl]amino]propanoic acid.
| Compound Name | 3-[ethyl-[4-(prop-2-ynylsulfamoyl)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119191082 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 3-[ethyl-[4-(prop-2-ynylsulfamoyl)benzoyl]amino]propanoic acid |
| SMILES | C#CCNS(=O)(=O)c1ccc(C(=O)N(CC)CCC(=O)O)cc1 |
| InChI | InChI=1S/C15H18N2O5S/c1-3-10-16-23(21,22)13-7-5-12(6-8-13)15(20)17(4-2)11-9-14(18)19/h1,5-8,16H,4,9-11H2,2H3,(H,18,19) |
| InChIKey | WSVLAJTXYXYXLL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|