C16H22N2O5 — CID 119192065
2-[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]-2-methylpentanoic acid (PubChem CID 119192065) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is 2-[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]-2-methylpentanoic acid.
| Compound Name | 2-[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 119192065 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2-[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]-2-methylpentanoic acid |
| SMILES | CCCC(C)(NC(=O)C1CC(=O)N(Cc2ccco2)C1)C(=O)O |
| InChI | InChI=1S/C16H22N2O5/c1-3-6-16(2,15(21)22)17-14(20)11-8-13(19)18(9-11)10-12-5-4-7-23-12/h4-5,7,11H,3,6,8-10H2,1-2H3,(H,17,20)(H,21,22) |
| InChIKey | PDOSPEIRAZDDDH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |